Compound Information | SONAR Target prediction | Name: | ISOTECTORIGENIN TRIMETHYL ETHER | Unique Identifier: | SPE00201341 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C19H18O6 | Molecular Weight: | 324.2 g/mol | X log p: | 14.131 (online calculus) | Lipinksi Failures | 1 | TPSA | 63.22 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1ccc(cc1)C1=COc2c(OC)c(OC)cc(OC)c2C1=O | Source: | parent ex Dalbergia spp, Millettia auriculata |
Species: |
4932 |
Condition: |
MRT4 |
Replicates: |
2 |
Raw OD Value: r im |
0.5034±0.0721249 |
Normalized OD Score: sc h |
0.9813±0.022821 |
Z-Score: |
-0.5672±0.667512 |
p-Value: |
0.611456 |
Z-Factor: |
-9.6195 |
Fitness Defect: |
0.4919 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|B9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.00 Celcius | Date: | 2007-08-30 YYYY-MM-DD | Plate CH Control (+): | 0.039575±0.00097 | Plate DMSO Control (-): | 0.49895±0.05319 | Plate Z-Factor: | 0.4225 |
| png ps pdf |
DBLink | Rows returned: 2 | |
253929 |
5,6,7,8-tetramethoxy-3-(4-methoxyphenyl)chromen-4-one |
3279840 |
5,7,8-trimethoxy-3-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5360 | Additional Members: 5 | Rows returned: 4 | |
|