Compound Information | SONAR Target prediction | Name: | 7,8-DIHYDROXYFLAVONE | Unique Identifier: | SPE00201315 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 244.158 g/mol | X log p: | 17.144 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc2C(=O)C=C(Oc2c1O)c1ccccc1 | Class: | flavone | Source: | Godmania aesculifolia | Reference: | J Chem Soc 1939: 956, 958; 1956:4170 | Therapeutics: | vascular protectant, antihaemorrhagic |
Species: |
4932 |
Condition: |
TEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5140±0.0322441 |
Normalized OD Score: sc h |
0.8274±0.0327819 |
Z-Score: |
-4.5819±0.594587 |
p-Value: |
0.0000160973 |
Z-Factor: |
-0.269454 |
Fitness Defect: |
11.0369 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|G4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.40 Celcius | Date: | 2005-12-23 YYYY-MM-DD | Plate CH Control (+): | 0.038650000000000004±0.00137 | Plate DMSO Control (-): | 0.5917749999999999±0.02659 | Plate Z-Factor: | 0.8616 |
| png ps pdf |
DBLink | Rows returned: 1 | |
1880 |
7,8-dihydroxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 6 | |
nonactive | Cluster 8175 | Additional Members: 1 | Rows returned: 0 | |
|