| Compound Information | SONAR Target prediction | | Name: | 7,8-DIHYDROXYFLAVONE | | Unique Identifier: | SPE00201315 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 17.144 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc2C(=O)C=C(Oc2c1O)c1ccccc1 | | Class: | flavone | | Source: | Godmania aesculifolia | | Reference: | J Chem Soc 1939: 956, 958; 1956:4170 | | Therapeutics: | vascular protectant, antihaemorrhagic |
| Species: |
4932 |
| Condition: |
POL32 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5291±0.0541644 |
| Normalized OD Score: sc h |
0.9214±0.0371206 |
| Z-Score: |
-2.1910±1.03586 |
| p-Value: |
0.0740724 |
| Z-Factor: |
-2.04093 |
| Fitness Defect: |
2.6027 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 7|G4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.10 Celcius | | Date: | 2006-02-16 YYYY-MM-DD | | Plate CH Control (+): | 0.039099999999999996±0.00068 | | Plate DMSO Control (-): | 0.565025±0.02016 | | Plate Z-Factor: | 0.8555 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 1880 |
7,8-dihydroxy-2-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 6 | |
| active | Cluster 8175 | Additional Members: 1 | Rows returned: 0 | |
|
