| Compound Information | SONAR Target prediction |  | Name: | 7,8-DIHYDROXYFLAVONE |  | Unique Identifier: | SPE00201315  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 17.144  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1ccc2C(=O)C=C(Oc2c1O)c1ccccc1 |  | Class: | flavone |  | Source: | Godmania aesculifolia |  | Reference: | J Chem Soc 1939: 956, 958; 1956:4170 |  | Therapeutics: | vascular protectant, antihaemorrhagic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BY4741 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7254±0.00707107 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0048±0.00144551 | 
	 
	
		| Z-Score: | 
		0.0307±0.0846637 | 
	 
	
		| p-Value: | 
		0.952284 | 
	 
	
		| Z-Factor: | 
		-14.6563 | 
	 
	
		| Fitness Defect: | 
		0.0489 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 25|A10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.90 Celcius |  | Date: | 2008-08-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.04397499999999999±0.00188 |  | Plate DMSO Control (-): | 0.711425±0.01430 |  | Plate Z-Factor: | 0.9288 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 1880 | 
		7,8-dihydroxy-2-phenyl-chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 6 |  |   
 |  active | Cluster 8175 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |