Compound Information | SONAR Target prediction | Name: | DALBERGIONE | Unique Identifier: | SPE00201281 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 212.159 g/mol | X log p: | 18.209 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 3 | Canonical Smiles: | C=CC(c1ccccc1)c1cc(=O)ccc1=O | Class: | quinone | Source: | Dalbergia spp |
Species: |
4932 |
Condition: |
SPE01502019 |
Replicates: |
2 |
Raw OD Value: r im |
0.4117±0.0178898 |
Normalized OD Score: sc h |
0.8273±0.0303602 |
Z-Score: |
-5.2045±0.660819 |
p-Value: |
0.00000109008 |
Z-Factor: |
-7.42425 |
Fitness Defect: |
13.7293 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2007-01-17 YYYY-MM-DD | Plate CH Control (+): | 0.27514999999999995±0.01002 | Plate DMSO Control (-): | 0.5260499999999999±1.72264 | Plate Z-Factor: | 0.7583 |
| png ps pdf |
DBLink | Rows returned: 1 | |
99926 |
2-methoxy-5-(1-phenylprop-2-enyl)cyclohexa-2,5-diene-1,4-dione |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 9726 | Additional Members: 2 | Rows returned: 1 | |
|