| Compound Information | SONAR Target prediction |  | Name: | DALBERGIONE |  | Unique Identifier: | SPE00201281  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 212.159 g/mol |  | X log p: | 18.209  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | C=CC(c1ccccc1)c1cc(=O)ccc1=O |  | Class: | quinone |  | Source: | Dalbergia spp |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00201697 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6836±0.017112 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0237±0.00940498 | 
	 
	
		| Z-Score: | 
		1.0682±0.453442 | 
	 
	
		| p-Value: | 
		0.309816 | 
	 
	
		| Z-Factor: | 
		-3.3886 | 
	 
	
		| Fitness Defect: | 
		1.1718 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|C3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.80 Celcius |  | Date: | 2006-12-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.039975±0.00146 |  | Plate DMSO Control (-): | 0.65595±0.01396 |  | Plate Z-Factor: | 0.9195 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 99926 | 
		2-methoxy-5-(1-phenylprop-2-enyl)cyclohexa-2,5-diene-1,4-dione | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 9726 | Additional Members: 2 | Rows returned: 1 |  |   
 
 |