| Compound Information | SONAR Target prediction | | Name: | DALBERGIONE | | Unique Identifier: | SPE00201281 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 212.159 g/mol | | X log p: | 18.209 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | C=CC(c1ccccc1)c1cc(=O)ccc1=O | | Class: | quinone | | Source: | Dalbergia spp |
| Species: |
4932 |
| Condition: |
SPE01501116 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5999±0.00954594 |
| Normalized OD Score: sc h |
1.0110±0.00439893 |
| Z-Score: |
0.3811±0.178099 |
| p-Value: |
0.705376 |
| Z-Factor: |
-5.17525 |
| Fitness Defect: |
0.349 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2007-01-10 YYYY-MM-DD | | Plate CH Control (+): | 0.039099999999999996±0.00151 | | Plate DMSO Control (-): | 0.585475±0.06554 | | Plate Z-Factor: | 0.7163 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 99926 |
2-methoxy-5-(1-phenylprop-2-enyl)cyclohexa-2,5-diene-1,4-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9726 | Additional Members: 2 | Rows returned: 1 | |
|