Compound Information | SONAR Target prediction | Name: | DALBERGIONE | Unique Identifier: | SPE00201281 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 212.159 g/mol | X log p: | 18.209 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 3 | Canonical Smiles: | C=CC(c1ccccc1)c1cc(=O)ccc1=O | Class: | quinone | Source: | Dalbergia spp |
Species: |
4932 |
Condition: |
SPE01500255 |
Replicates: |
2 |
Raw OD Value: r im |
0.6418±0.0243952 |
Normalized OD Score: sc h |
1.0032±0.0127638 |
Z-Score: |
0.1535±0.562739 |
p-Value: |
0.69413 |
Z-Factor: |
-11.2639 |
Fitness Defect: |
0.3651 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.10 Celcius | Date: | 2006-12-22 YYYY-MM-DD | Plate CH Control (+): | 0.038625±0.00223 | Plate DMSO Control (-): | 0.6391±0.02223 | Plate Z-Factor: | 0.8983 |
| png ps pdf |
DBLink | Rows returned: 1 | |
99926 |
2-methoxy-5-(1-phenylprop-2-enyl)cyclohexa-2,5-diene-1,4-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9726 | Additional Members: 2 | Rows returned: 1 | |
|