Compound Information | SONAR Target prediction | Name: | IRIGENOL | Unique Identifier: | SPE00201182 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 308.156 g/mol | X log p: | 10.399 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc2OC=C(C(=O)c2c(O)c1O)c1cc(O)c(O)c(O)c1 | Class: | isoflavone | Source: | Iris spp |
Species: |
4932 |
Condition: |
FKS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6077±0.0173948 |
Normalized OD Score: sc h |
0.6481±0.0450917 |
Z-Score: |
-6.7068±0.0803898 |
p-Value: |
0.0000000000213858 |
Z-Factor: |
0.255191 |
Fitness Defect: |
24.5683 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2008-06-04 YYYY-MM-DD | Plate CH Control (+): | 0.040999999999999995±0.00074 | Plate DMSO Control (-): | 0.62485±0.01707 | Plate Z-Factor: | 0.8984 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5781144 |
5,6,7-trihydroxy-3-(3,4,5-trihydroxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 3206 | Additional Members: 1 | Rows returned: 0 | |
|