| Compound Information | SONAR Target prediction | | Name: | IRIGENOL | | Unique Identifier: | SPE00201182 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 308.156 g/mol | | X log p: | 10.399 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc2OC=C(C(=O)c2c(O)c1O)c1cc(O)c(O)c(O)c1 | | Class: | isoflavone | | Source: | Iris spp |
| Species: |
4932 |
| Condition: |
SET2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7013±0.00296985 |
| Normalized OD Score: sc h |
0.9822±0.00530515 |
| Z-Score: |
-1.0433±0.314799 |
| p-Value: |
0.308662 |
| Z-Factor: |
-7.26693 |
| Fitness Defect: |
1.1755 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|A4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.00 Celcius | | Date: | 2007-11-15 YYYY-MM-DD | | Plate CH Control (+): | 0.041225±0.00108 | | Plate DMSO Control (-): | 0.709425±0.02013 | | Plate Z-Factor: | 0.9053 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5781144 |
5,6,7-trihydroxy-3-(3,4,5-trihydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 3206 | Additional Members: 1 | Rows returned: 0 | |
|