| Compound Information | SONAR Target prediction | | Name: | IRIGENOL | | Unique Identifier: | SPE00201182 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 308.156 g/mol | | X log p: | 10.399 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc2OC=C(C(=O)c2c(O)c1O)c1cc(O)c(O)c(O)c1 | | Class: | isoflavone | | Source: | Iris spp |
| Species: |
4932 |
| Condition: |
RBL2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7058±0.00318198 |
| Normalized OD Score: sc h |
1.0000±0.000179761 |
| Z-Score: |
-0.0026±0.00874704 |
| p-Value: |
0.995066 |
| Z-Factor: |
-18.77 |
| Fitness Defect: |
0.0049 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 24|C11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.50 Celcius | | Date: | 2008-06-03 YYYY-MM-DD | | Plate CH Control (+): | 0.040575±0.00425 | | Plate DMSO Control (-): | 0.69155±0.01321 | | Plate Z-Factor: | 0.9525 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5781144 |
5,6,7-trihydroxy-3-(3,4,5-trihydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 3206 | Additional Members: 1 | Rows returned: 0 | |
|
