| Compound Information | SONAR Target prediction |  | Name: | IRIGENOL |  | Unique Identifier: | SPE00201182  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 308.156 g/mol |  | X log p: | 10.399  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1cc2OC=C(C(=O)c2c(O)c1O)c1cc(O)c(O)c(O)c1 |  | Class: | isoflavone |  | Source: | Iris spp |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RBL2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7058±0.00318198 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0000±0.000179761 | 
	 
	
		| Z-Score: | 
		-0.0026±0.00874704 | 
	 
	
		| p-Value: | 
		0.995066 | 
	 
	
		| Z-Factor: | 
		-18.77 | 
	 
	
		| Fitness Defect: | 
		0.0049 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 24|C11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.50 Celcius |  | Date: | 2008-06-03 YYYY-MM-DD |  | Plate CH Control (+): | 0.040575±0.00425 |  | Plate DMSO Control (-): | 0.69155±0.01321 |  | Plate Z-Factor: | 0.9525 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 5781144 | 
		5,6,7-trihydroxy-3-(3,4,5-trihydroxyphenyl)chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 7 | 1 2 Next >>  |   
 |  active | Cluster 3206 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |