Compound Information | SONAR Target prediction | Name: | IRIGENOL | Unique Identifier: | SPE00201182 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 308.156 g/mol | X log p: | 10.399 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc2OC=C(C(=O)c2c(O)c1O)c1cc(O)c(O)c(O)c1 | Class: | isoflavone | Source: | Iris spp |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.6205±0.00452548 |
Normalized OD Score: sc h |
0.8175±0.0000528395 |
Z-Score: |
-4.9351±0.177133 |
p-Value: |
0.000000964728 |
Z-Factor: |
0.549793 |
Fitness Defect: |
13.8514 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|A4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2006-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.03875±0.00135 | Plate DMSO Control (-): | 0.760575±0.01986 | Plate Z-Factor: | 0.9112 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5781144 |
5,6,7-trihydroxy-3-(3,4,5-trihydroxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 7 | << Back 1 2 |
active | Cluster 3206 | Additional Members: 1 | Rows returned: 0 | |
|