| Compound Information | SONAR Target prediction |  | Name: | IRIGENIN, DIBENZYL ETHER |  | Unique Identifier: | SPE00201181  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H28O8 |  | Molecular Weight: | 512.338 g/mol |  | X log p: | 31.278  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 72.45 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 10 |  | Canonical Smiles: | COc1cc(cc(OCc2ccccc2)c1OC)C1=COc2cc(OCc3ccccc3)c(OC)c(O)c2C1=O |  | Source: | derivative of Irigenin |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		KGD1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6989±0.0106066 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9839±0.0038441 | 
	 
	
		| Z-Score: | 
		-0.9449±0.239607 | 
	 
	
		| p-Value: | 
		0.351582 | 
	 
	
		| Z-Factor: | 
		-7.83992 | 
	 
	
		| Fitness Defect: | 
		1.0453 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 9|G3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.00 Celcius |  | Date: | 2007-09-11 YYYY-MM-DD |  | Plate CH Control (+): | 0.03945±0.00037 |  | Plate DMSO Control (-): | 0.696825±0.02320 |  | Plate Z-Factor: | 0.8817 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 6710674 | 
		3-(3,4-dimethoxy-5-phenylmethoxy-phenyl)-5-hydroxy-6-methoxy-7-phenylmethoxy-chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  nonactive | Cluster 9315 | Additional Members: 4 | Rows returned: 3 |  |   
 
 |