Compound Information | SONAR Target prediction | Name: | IRIGENIN, DIBENZYL ETHER | Unique Identifier: | SPE00201181 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H28O8 | Molecular Weight: | 512.338 g/mol | X log p: | 31.278 (online calculus) | Lipinksi Failures | 1 | TPSA | 72.45 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 10 | Canonical Smiles: | COc1cc(cc(OCc2ccccc2)c1OC)C1=COc2cc(OCc3ccccc3)c(OC)c(O)c2C1=O | Source: | derivative of Irigenin |
Species: |
4932 |
Condition: |
CNB1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6927±0.00374767 |
Normalized OD Score: sc h |
0.9984±0.000671815 |
Z-Score: |
-0.0605±0.0259476 |
p-Value: |
0.951754 |
Z-Factor: |
-150.731 |
Fitness Defect: |
0.0494 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|G3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.50 Celcius | Date: | 2006-04-12 YYYY-MM-DD | Plate CH Control (+): | 0.03945±0.00170 | Plate DMSO Control (-): | 0.681225±0.01289 | Plate Z-Factor: | 0.9272 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6710674 |
3-(3,4-dimethoxy-5-phenylmethoxy-phenyl)-5-hydroxy-6-methoxy-7-phenylmethoxy-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 9315 | Additional Members: 4 | Rows returned: 2 | |
|