| Compound Information | SONAR Target prediction | | Name: | IRIGENIN, DIBENZYL ETHER | | Unique Identifier: | SPE00201181 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H28O8 | | Molecular Weight: | 512.338 g/mol | | X log p: | 31.278 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 72.45 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | COc1cc(cc(OCc2ccccc2)c1OC)C1=COc2cc(OCc3ccccc3)c(OC)c(O)c2C1=O | | Source: | derivative of Irigenin |
| Species: |
4932 |
| Condition: |
CLN2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6567±0 |
| Normalized OD Score: sc h |
0.9850±0.00138433 |
| Z-Score: |
-0.6724±0.0278413 |
| p-Value: |
0.50144 |
| Z-Factor: |
-4.49174 |
| Fitness Defect: |
0.6903 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 9|G3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2007-11-16 YYYY-MM-DD | | Plate CH Control (+): | 0.041775±0.00118 | | Plate DMSO Control (-): | 0.650325±0.03476 | | Plate Z-Factor: | 0.8133 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6710674 |
3-(3,4-dimethoxy-5-phenylmethoxy-phenyl)-5-hydroxy-6-methoxy-7-phenylmethoxy-chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 9315 | Additional Members: 4 | Rows returned: 3 | |
|
