Compound Information | SONAR Target prediction | Name: | IRIGENIN, DIBENZYL ETHER | Unique Identifier: | SPE00201181 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H28O8 | Molecular Weight: | 512.338 g/mol | X log p: | 31.278 (online calculus) | Lipinksi Failures | 1 | TPSA | 72.45 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 10 | Canonical Smiles: | COc1cc(cc(OCc2ccccc2)c1OC)C1=COc2cc(OCc3ccccc3)c(OC)c(O)c2C1=O | Source: | derivative of Irigenin |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.7272±0.00721249 |
Normalized OD Score: sc h |
1.0019±0.006755 |
Z-Score: |
0.0586±0.223906 |
p-Value: |
0.874414 |
Z-Factor: |
-26.4129 |
Fitness Defect: |
0.1342 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|G3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.40 Celcius | Date: | 2006-02-22 YYYY-MM-DD | Plate CH Control (+): | 0.041225±0.00256 | Plate DMSO Control (-): | 0.719725±0.01594 | Plate Z-Factor: | 0.8874 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6710674 |
3-(3,4-dimethoxy-5-phenylmethoxy-phenyl)-5-hydroxy-6-methoxy-7-phenylmethoxy-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
nonactive | Cluster 9315 | Additional Members: 4 | Rows returned: 3 | |
|