Compound Information | SONAR Target prediction | Name: | HYDROCOTOIN | Unique Identifier: | SPE00201081 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H14O4 | Molecular Weight: | 244.158 g/mol | X log p: | 15.451 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1cc(O)c(C(=O)c2ccccc2)c(OC)c1 | Source: | ex Nectandra coto |
Species: |
4932 |
Condition: |
SPE00201697 |
Replicates: |
2 |
Raw OD Value: r im |
0.6504±0.00855599 |
Normalized OD Score: sc h |
0.9820±0.00560607 |
Z-Score: |
-0.8099±0.2755 |
p-Value: |
0.426786 |
Z-Factor: |
-2.88468 |
Fitness Defect: |
0.8515 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.80 Celcius | Date: | 2006-12-15 YYYY-MM-DD | Plate CH Control (+): | 0.039975±0.00146 | Plate DMSO Control (-): | 0.65595±0.01396 | Plate Z-Factor: | 0.9195 |
| png ps pdf |
DBLink | Rows returned: 6 | |
77387 |
phenyl-(2,4,6-trimethoxyphenyl)methanone |
254174 |
(2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone |
520748 |
(2,4-dimethoxyphenyl)-phenyl-methanone |
688628 |
(2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone |
3646534 |
(2-hydroxy-4,6-dimethoxy-phenyl)-phenyl-methanone |
6710752 |
(4-hydroxyphenyl)-(2,4,6-trimethoxyphenyl)methanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 | |
|