| Compound Information | SONAR Target prediction |  | Name: | HYDROCOTOIN |  | Unique Identifier: | SPE00201081  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C15H14O4 |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 15.451  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1cc(O)c(C(=O)c2ccccc2)c(OC)c1 |  | Source: | ex Nectandra coto |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00330001 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5626±0.00735391 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9970±0.00463913 | 
	 
	
		| Z-Score: | 
		-0.1207±0.182956 | 
	 
	
		| p-Value: | 
		0.897808 | 
	 
	
		| Z-Factor: | 
		-3.47399 | 
	 
	
		| Fitness Defect: | 
		0.1078 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.20 Celcius |  | Date: | 2006-12-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.040925±0.00309 |  | Plate DMSO Control (-): | 0.5775±0.05969 |  | Plate Z-Factor: | 0.6948 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 6 |  |  
 
	
		| 77387 | 
		phenyl-(2,4,6-trimethoxyphenyl)methanone | 
	 
	
		| 254174 | 
		(2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone | 
	 
	
		| 520748 | 
		(2,4-dimethoxyphenyl)-phenyl-methanone | 
	 
	
		| 688628 | 
		(2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone | 
	 
	
		| 3646534 | 
		(2-hydroxy-4,6-dimethoxy-phenyl)-phenyl-methanone | 
	 
	
		| 6710752 | 
		(4-hydroxyphenyl)-(2,4,6-trimethoxyphenyl)methanone | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 |  |   
 
 |