| 
 | Compound Information | SONAR Target prediction |  | Name: | HYDROCOTOIN |  | Unique Identifier: | SPE00201081 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C15H14O4 |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 15.451  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1cc(O)c(C(=O)c2ccccc2)c(OC)c1 |  | Source: | ex Nectandra coto | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE00210369 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6077±0.00374767 |  
		| Normalized OD Score: sc h | 0.9948±0.00693793 |  
		| Z-Score: | -0.2486±0.325034 |  
		| p-Value: | 0.808718 |  
		| Z-Factor: | -83.5385 |  
		| Fitness Defect: | 0.2123 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.50 Celcius |  | Date: | 2006-12-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.043325±0.00034 |  | Plate DMSO Control (-): | 0.6113500000000001±0.04919 |  | Plate Z-Factor: | 0.7735 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 6 |  | 
 
	
		| 77387 | phenyl-(2,4,6-trimethoxyphenyl)methanone |  
		| 254174 | (2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone |  
		| 520748 | (2,4-dimethoxyphenyl)-phenyl-methanone |  
		| 688628 | (2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone |  
		| 3646534 | (2-hydroxy-4,6-dimethoxy-phenyl)-phenyl-methanone |  
		| 6710752 | (4-hydroxyphenyl)-(2,4,6-trimethoxyphenyl)methanone |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 |  | 
 
 |