Compound Information | SONAR Target prediction |
Name: | PINOSYLVIN |
Unique Identifier: | SPE00201066 |
MolClass: | Checkout models in ver1.5 and ver1.0 |
Molecular Formula: | C14H12O2 |
Molecular Weight: | 200.149 g/mol |
X log p: | 21.077 (online calculus) |
Lipinksi Failures | 1 |
TPSA | 0 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptors Count: | 2 |
Rotatable Bond Count: | 2 |
Canonical Smiles: | Oc1cc(O)cc(C=Cc2ccccc2)c1 |
Source: | ex heartwood of Pinus sylvestris |
Reference: | J Am Chem Soc 62: 3512 (1940) |