Compound Information | SONAR Target prediction | Name: | IRIGENIN TRIMETHYL ETHER | Unique Identifier: | SPE00200873 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.22 g/mol | X log p: | 10.801 (online calculus) | Lipinksi Failures | 1 | TPSA | 81.68 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 7 | Canonical Smiles: | COc1cc2OC=C(C(=O)c2c(OC)c1OC)c1cc(OC)c(OC)c(OC)c1 | Class: | isoflavone | Source: | derivative | Reference: | Prog Chem Org Nat Prod 43: 1 (1983) |
Species: |
4932 |
Condition: |
POM152 |
Replicates: |
2 |
Raw OD Value: r im |
0.7014±0.0098995 |
Normalized OD Score: sc h |
0.9893±0.00656681 |
Z-Score: |
-0.5700±0.351169 |
p-Value: |
0.580454 |
Z-Factor: |
-3.11508 |
Fitness Defect: |
0.5439 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.40 Celcius | Date: | 2008-03-15 YYYY-MM-DD | Plate CH Control (+): | 0.04105±0.00067 | Plate DMSO Control (-): | 0.693175±0.00739 | Plate Z-Factor: | 0.9631 |
| png ps pdf |
DBLink | Rows returned: 1 | |
4303569 |
5,6,7-trimethoxy-3-(3,4,5-trimethoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 1426 | Additional Members: 2 | Rows returned: 1 | |
|