| Compound Information | SONAR Target prediction |  | Name: | IRIGENIN TRIMETHYL ETHER |  | Unique Identifier: | SPE00200873  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 380.22 g/mol |  | X log p: | 10.801  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 81.68 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | COc1cc2OC=C(C(=O)c2c(OC)c1OC)c1cc(OC)c(OC)c(OC)c1 |  | Class: | isoflavone |  | Source: | derivative |  | Reference: | Prog Chem Org Nat Prod 43: 1 (1983) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ELF1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6132±0.00933381 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9939±0.00545003 | 
	 
	
		| Z-Score: | 
		-0.2496±0.223025 | 
	 
	
		| p-Value: | 
		0.805296 | 
	 
	
		| Z-Factor: | 
		-167.725 | 
	 
	
		| Fitness Defect: | 
		0.2165 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 13|E3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.30 Celcius |  | Date: | 2008-07-11 YYYY-MM-DD |  | Plate CH Control (+): | 0.041499999999999995±0.00029 |  | Plate DMSO Control (-): | 0.633025±0.03557 |  | Plate Z-Factor: | 0.8109 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 4303569 | 
		5,6,7-trimethoxy-3-(3,4,5-trimethoxyphenyl)chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  nonactive | Cluster 1426 | Additional Members: 2 | Rows returned: 1 |  |   
 
 |