| Compound Information | SONAR Target prediction | 
| Name: | ROTENONIC ACID | 
| Unique Identifier: | SPE00200851 | 
| MolClass: | Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 374.258 g/mol | 
| X log p: | 11.373  (online calculus) | 
| Lipinksi Failures | 1 | 
| TPSA | 53.99 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 6 | 
| Rotatable Bond Count: | 4 | 
| Canonical Smiles: | COc1cc2OCC3Oc4c(CC=C(C)C)c(O)ccc4C(=O)C3c2cc1OC | 
| Class: | rotenoid | 
| Source: | derivative of rotenone (00200013) | 
| Reference: | Chem Rev 12: 181 (1933); Phytochemistry 21: 949 (1982) |