| Compound Information | SONAR Target prediction |
| Name: | APIGENIN |
| Unique Identifier: | SPE00200846 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H10O5 |
| Molecular Weight: | 260.158 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Oc1ccc(cc1)C1Oc2cc(O)cc(O)c2C(=O)C=1 |
| Class: | flavone |
| Source: | parsley seed |
| Reference: | J Chem Soc 1963: 1477; Eur J Cancer 32A: 146 (1996); J Biol Chem 271: 2262 (1996); Carcinogenesis 10: 2325 (1994) |
| Therapeutics: | antispasmodic, antineoplastic, topoisomerase I inhibitor |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 101 102 103 104 Next >> [104] |
| Species: | 4932 |
| Condition: | WHI5 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6886±0.00827315 |
| Normalized OD Score: sc h | 1.0181±0.0000419851 |
| Z-Score: | 0.8274±0.0118411 |
| p-Value: | 0.408038 |
| Z-Factor: | -1.57612 |
| Fitness Defect: | 0.8964 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 |
| SPE01500724 | 0.345454545454545 |
| SPE01504115 | 0.294117647058823 |
| SPE00200499 | 0.24 |
| SPE01505144 | 0.191489361702128 |
| SPE01500709 | 0.191489361702128 |
| Prest122 | 0.1875 |
Service provided by the
Mike Tyers Laboratory