| Compound Information | SONAR Target prediction |  | Name: | IRIDIN |  | Unique Identifier: | SPE00200793  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 496.249 g/mol |  | X log p: | 9.483  (online calculus) |  | Lipinksi Failures | 2 |  | TPSA | 72.45 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 13 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | COc1cc(cc(O)c1OC)C1=COc2cc(OC3OC(CO)C(O)C(O)C3O)c(OC)c(O)c2C1=O |  | Class: | isoflavone glycoside |  | Source: | Iris spp. |  | Reference: | J Chem Soc 1928:1022; Phytochemistry 22:2061 (1983); Prog Chem Org Nat Prod 43:1 (1983) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		NUP100 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7227±0.0214253 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9951±0.00235541 | 
	 
	
		| Z-Score: | 
		-0.3368±0.158276 | 
	 
	
		| p-Value: | 
		0.737832 | 
	 
	
		| Z-Factor: | 
		-13.9298 | 
	 
	
		| Fitness Defect: | 
		0.304 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|G11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 28.50 Celcius |  | Date: | 2007-08-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.04045±0.00222 |  | Plate DMSO Control (-): | 0.705675±0.01810 |  | Plate Z-Factor: | 0.9089 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 4 |  |  
 
	
		| 5281777 | 
		5-hydroxy-3-(3-hydroxy-4,5-dimethoxy-phenyl)-6-methoxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxyme thyl)oxan-2-yl]oxy-chromen-4-one | 
	 
	
		| 5318472 | 
		5-hydroxy-3-(3-hydroxy-4,5-dimethoxy-phenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxyme thyl)oxan-2-yl]oxy-chromen-4-one | 
	 
	
		| 5318487 | 
		5-hydroxy-3-(4-hydroxy-3-methoxy-phenyl)-6-methoxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl )oxan-2-yl]oxy-chromen-4-one | 
	 
	
		| 6063288 | 
		5-hydroxy-3-(3-hydroxy-4,5-dimethoxy-phenyl)-6-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ox y-chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  nonactive | Cluster 9315 | Additional Members: 4 | Rows returned: 3 |  |   
 
 |