| Compound Information | SONAR Target prediction |
| Name: | DAIDZEIN |
| Unique Identifier: | SPE00200789 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 244.158 g/mol |
| X log p: | 16.755 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 26.3 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | Oc1ccc(cc1)C1=COc2cc(O)ccc2C1=O |
| Class: | isoflavone |
| Source: | red clover |
| Reference: | J Chem Soc 1933: 274 |
| Therapeutics: | phytoestrogen |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 171 172 173 174 175 176 177 178 179 180 Next >> [205] |
| Species: | 4932 |
| Condition: | RSC2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.3394±0.0039598 |
| Normalized OD Score: sc h | 0.9412±0.0267647 |
| Z-Score: | -1.5968±0.760038 |
| p-Value: | 0.161139 |
| Z-Factor: | -1.98558 |
| Fitness Defect: | 1.8255 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 5281708 | 7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 16 | << Back 1 2 3 |
| LOPAC 00433 | 0.9832 |
| SPE00102007 | 0.9915 |
| RJC 00206 | 0.9915 |
| LOPAC 00426 | 1.0000 |
| active | Cluster 8155 | Additional Members: 16 | Rows returned: 3 |
| SPE00200422 | 0.396551724137931 |
| SPE00201187 | 0.296296296296296 |
| SPE00102007 | 0 |
Service provided by the
Mike Tyers Laboratory