| 
 | Compound Information | SONAR Target prediction |  | Name: | IRIGENIN, 7-BENZYL ETHER |  | Unique Identifier: | SPE00200763 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C25H22O8 |  | Molecular Weight: | 428.263 g/mol |  | X log p: | 20.51  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 63.22 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | COc1cc(cc(O)c1OC)C1=COc2cc(OCc3ccccc3)c(OC)c(O)c2C1=O |  | Source: | derivative of irigenin from Iris spp. | 
 
 
	
		| Species: | 4932 |  
		| Condition: | UBP8 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5876±0.00685894 |  
		| Normalized OD Score: sc h | 0.8768±0.00516044 |  
		| Z-Score: | -5.0766±0.215132 |  
		| p-Value: | 0.000000508368 |  
		| Z-Factor: | 0.0000766509 |  
		| Fitness Defect: | 14.4921 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|G10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.60 Celcius |  | Date: | 2007-10-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.04±0.00030 |  | Plate DMSO Control (-): | 0.6454249999999999±0.02382 |  | Plate Z-Factor: | 0.8875 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 6063287 | 5-hydroxy-3-(3-hydroxy-4,5-dimethoxy-phenyl)-6-methoxy-7-phenylmethoxy-chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 9315 | Additional Members: 4 | Rows returned: 1 |  | 
 
 |