| Compound Information | SONAR Target prediction | | Name: | IRIGENIN, 7-BENZYL ETHER | | Unique Identifier: | SPE00200763 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C25H22O8 | | Molecular Weight: | 428.263 g/mol | | X log p: | 20.51 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 63.22 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | COc1cc(cc(O)c1OC)C1=COc2cc(OCc3ccccc3)c(OC)c(O)c2C1=O | | Source: | derivative of irigenin from Iris spp. |
| Species: |
4932 |
| Condition: |
CLN2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7240±0.00424264 |
| Normalized OD Score: sc h |
1.0060±0.00501765 |
| Z-Score: |
0.3634±0.243149 |
| p-Value: |
0.720264 |
| Z-Factor: |
-23.0801 |
| Fitness Defect: |
0.3281 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 15|F11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.1025±0.00877 | | Plate DMSO Control (-): | 0.87875±0.03344 | | Plate Z-Factor: | 0.8863 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6063287 |
5-hydroxy-3-(3-hydroxy-4,5-dimethoxy-phenyl)-6-methoxy-7-phenylmethoxy-chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 9315 | Additional Members: 4 | Rows returned: 1 | |
|
