Compound Information | SONAR Target prediction | Name: | ERGOSTEROL ACETATE | Unique Identifier: | SPE00200744 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 416.341 g/mol | X log p: | 9.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CC=C4C(C)(C)C(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | derivative; mp 179-181 C |
Species: |
4932 |
Condition: |
UBP6 |
Replicates: |
2 |
Raw OD Value: r im |
0.6365±0.00289914 |
Normalized OD Score: sc h |
1.0403±0.0068939 |
Z-Score: |
1.6195±0.177588 |
p-Value: |
0.108083 |
Z-Factor: |
-1.72538 |
Fitness Defect: |
2.2249 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|D5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2008-01-24 YYYY-MM-DD | Plate CH Control (+): | 0.0421±0.00062 | Plate DMSO Control (-): | 0.5894999999999999±0.01886 | Plate Z-Factor: | 0.8890 |
| png ps pdf |
281927 |
[17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phen anthren-3-yl] acetate |
4035379 |
[17-(5,6-dimethylhept-3-en-2-yl)-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta[a]p henanthren-3-yl] acetate |
4206521 |
[17-(5-ethyl-6-methyl-hept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a ]phenanthren-3-yl] acetate |
5363270 |
[17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a] phenanthren-3-yl] acetate |
5379846 |
[10,13-dimethyl-17-[(E)-7-methyl-5-propan-2-yl-oct-5-en-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate |
5993710 |
[17-[(E)-5,6-dimethylhept-3-en-2-yl]-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta [a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 5085 | Additional Members: 3 | Rows returned: 2 | |
|