| 
 | Compound Information | SONAR Target prediction |  | Name: | ERGOSTEROL ACETATE |  | Unique Identifier: | SPE00200744 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 416.341 g/mol |  | X log p: | 9.421  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CC=C4C(C)(C)C(CCC4(C)C3CCC12C)OC(C)=O |  | Class: | sterol |  | Source: | derivative; mp 179-181 C | 
 
 
	
		| Species: | 4932 |  
		| Condition: | HXK2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7636±0.00155563 |  
		| Normalized OD Score: sc h | 1.0347±0.00639262 |  
		| Z-Score: | 1.5409±0.25069 |  
		| p-Value: | 0.12923 |  
		| Z-Factor: | -1.92847 |  
		| Fitness Defect: | 2.0462 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 12|D5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.50 Celcius |  | Date: | 2008-03-05 YYYY-MM-DD |  | Plate CH Control (+): | 0.040725±0.00075 |  | Plate DMSO Control (-): | 0.7232000000000001±0.01858 |  | Plate Z-Factor: | 0.9071 | 
 |  png ps
 pdf
 | 
 
 
	
		| 281927 | [17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phen anthren-3-yl] acetate
 |  
		| 4035379 | [17-(5,6-dimethylhept-3-en-2-yl)-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta[a]p henanthren-3-yl] acetate
 |  
		| 4206521 | [17-(5-ethyl-6-methyl-hept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a ]phenanthren-3-yl] acetate
 |  
		| 5363270 | [17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a] phenanthren-3-yl] acetate
 |  
		| 5379846 | [10,13-dimethyl-17-[(E)-7-methyl-5-propan-2-yl-oct-5-en-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate
 |  
		| 5993710 | [17-[(E)-5,6-dimethylhept-3-en-2-yl]-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta [a]phenanthren-3-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |