| Compound Information | SONAR Target prediction |  | Name: | ERGOSTEROL ACETATE |  | Unique Identifier: | SPE00200744  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 416.341 g/mol |  | X log p: | 9.421  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CC=C4C(C)(C)C(CCC4(C)C3CCC12C)OC(C)=O |  | Class: | sterol |  | Source: | derivative; mp 179-181 C |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		YPT6 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.3464±0.017607 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0380±0.107567 | 
	 
	
		| Z-Score: | 
		0.6196±1.00162 | 
	 
	
		| p-Value: | 
		0.556802 | 
	 
	
		| Z-Factor: | 
		-9.57904 | 
	 
	
		| Fitness Defect: | 
		0.5855 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|B2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.10 Celcius |  | Date: | 2006-02-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.040875±0.00082 |  | Plate DMSO Control (-): | 0.312075±0.03162 |  | Plate Z-Factor: | 0.6029 |  
  |  png ps pdf |  
 
 
	
		| 6036492 | 
		[17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopen ta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6432261 | 
		[(3S)-17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopen ta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6436903 | 
		[(3S,9R,10R,13S,14R,17R)-17-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16 ,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |