Compound Information | SONAR Target prediction | Name: | ERGOSTEROL | Unique Identifier: | SPE00200743 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 9.518 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CC=C4CC(O)CCC4(C)C3CCC12C | Class: | sterol | Source: | yeast | Reference: | J Biol Chem 80: 15 (1928) | Generic_name: | ERGOSTEROL | Chemical_iupac_name: | ERGOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01694 | Drugbank_id: | EXPT01357 | Logp: | 6.804 | Cas_registry_number: | 57-87-4 | Drug_category: | Beta-Cryptogein inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
RAD52 |
Replicates: |
2 |
Raw OD Value: r im |
0.5605±0.00721249 |
Normalized OD Score: sc h |
0.9729±0.00248416 |
Z-Score: |
-1.1428±0.0918383 |
p-Value: |
0.254112 |
Z-Factor: |
-5.01225 |
Fitness Defect: |
1.37 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|G8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.90 Celcius | Date: | 2007-10-26 YYYY-MM-DD | Plate CH Control (+): | 0.04115±0.00048 | Plate DMSO Control (-): | 0.5557749999999999±0.02951 | Plate Z-Factor: | 0.8135 |
| png ps pdf |
101705 |
17-(5-ethyl-6-methyl-hept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a] phenanthren-3-ol |
247705 |
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phena nthren-3-ol |
439550 |
(3S,9R,10R,13S,14R,17R)-17-[(2S,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17 -decahydro-1H-cyclopenta[a]phenanthren-3-ol |
439812 |
(3S)-10,13-dimethyl-17-(6-methyl-5-methylidene-hept-3-en-2-yl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cy clopenta[a]phenanthren-3-ol |
440671 |
10,13-dimethyl-17-(6-methyl-5-methylidene-hept-3-en-2-yl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclope nta[a]phenanthren-3-ol |
444679 |
(3S,9R,10R,13S,14R,17R)-17-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 0 | |
|