| Compound Information | SONAR Target prediction | | Name: | ERGOSTEROL | | Unique Identifier: | SPE00200743 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.299 g/mol | | X log p: | 9.518 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CC=C4CC(O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | yeast | | Reference: | J Biol Chem 80: 15 (1928) | | Generic_name: | ERGOSTEROL | | Chemical_iupac_name: | ERGOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01694 | | Drugbank_id: | EXPT01357 | | Logp: | 6.804 | | Cas_registry_number: | 57-87-4 | | Drug_category: | Beta-Cryptogein inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
SPT3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2971±0.0694379 |
| Normalized OD Score: sc h |
0.6351±0.0836016 |
| Z-Score: |
-5.7592±1.18758 |
| p-Value: |
0.000000434068 |
| Z-Factor: |
-0.135369 |
| Fitness Defect: |
14.6501 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 24|H10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.40 Celcius | | Date: | 2008-02-13 YYYY-MM-DD | | Plate CH Control (+): | 0.040625±0.00054 | | Plate DMSO Control (-): | 0.43672500000000003±0.02170 | | Plate Z-Factor: | 0.8180 |
|  png
ps
pdf |
| 5351845 |
(3S,10R,13S)-17-[(E,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1
H-cyclopenta[a]phenanthren-3-ol |
| 5364648 |
10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phena
nthren-3-ol |
| 5379591 |
17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopent
a[a]phenanthren-3-ol |
| 5460141 |
(3S,10R,13S)-10,13-dimethyl-17-[(E)-6-methyl-5-methylidene-hept-3-en-2-yl]-2,3,4,9,11,12,14,15,16,17-dec
ahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 5771570 |
(3S,9R,10R,13R,14R,17S)-17-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,
17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 6428654 |
(3S)-17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cycl
openta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 5085 | Additional Members: 3 | Rows returned: 0 | |
|
