| Compound Information | SONAR Target prediction |
| Name: | HYPOPROTOCETRARIC ACID |
| Unique Identifier: | SPE00200489 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C18H16O7 |
| Molecular Weight: | 328.188 g/mol |
| X log p: | 1.947 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | Cc1cc(O)c(C)c2Oc3c(C)c(C(O)=O)c(O)c(C)c3OC(=O)c12 |
| Source: | constitutent of lichens: Ramalina spp. |
| Reference: | Phytochemistry 4: 951 (1965) |
| Found: 101 nonactive as graph: single | with analogs | [1] << Back 51 52 53 54 55 56 57 58 59 60 Next >> [101] |
| Species: | 4932 |
| Condition: | MT2481-pdr1pdr3-2nd |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5555±0.0000707107 |
| Normalized OD Score: sc h | 0.9754±0.00184988 |
| Z-Score: | -1.0827±0.0273658 |
| p-Value: | 0.279032 |
| Z-Factor: | -11.8123 |
| Fitness Defect: | 1.2764 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 627044 |
| internal high similarity DBLink | Rows returned: 2 |
| SPE01504106 | 0.9200 |
| SPE00200040 | 0.9262 |
| active | Cluster 16309 | Additional Members: 2 | Rows returned: 1 |
| SPE00200054 | 0 |
Service provided by the
Mike Tyers Laboratory