| Compound Information | SONAR Target prediction | | Name: | ISOEUGENITOL | | Unique Identifier: | SPE00200449 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 196.115 g/mol | | X log p: | 4.311 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1Oc2c(C)c(O)cc(O)c2C(=O)C=1 | | Class: | chromone | | Source: | Eugenia caryophyllata | | Reference: | Helv Chim Acta 31: 1603 (1948) |
| Species: |
4932 |
| Condition: |
SLT2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7603±0.00657609 |
| Normalized OD Score: sc h |
0.9960±0.000152435 |
| Z-Score: |
-0.1994±0.00787535 |
| p-Value: |
0.841962 |
| Z-Factor: |
-4.4313 |
| Fitness Defect: |
0.172 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|G2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.00 Celcius | | Date: | 2006-03-21 YYYY-MM-DD | | Plate CH Control (+): | 0.038425±0.00100 | | Plate DMSO Control (-): | 0.7483500000000001±0.00817 | | Plate Z-Factor: | 0.9533 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5318562 |
5,7-dihydroxy-2,8-dimethyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 823 | Additional Members: 1 | Rows returned: 0 | |
|
