Compound Information | SONAR Target prediction | Name: | ISOEUGENITOL | Unique Identifier: | SPE00200449 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.115 g/mol | X log p: | 4.311 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1Oc2c(C)c(O)cc(O)c2C(=O)C=1 | Class: | chromone | Source: | Eugenia caryophyllata | Reference: | Helv Chim Acta 31: 1603 (1948) |
Species: |
4932 |
Condition: |
KRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8138±0.0115258 |
Normalized OD Score: sc h |
0.9910±0.0212601 |
Z-Score: |
0.5666±1.14925 |
p-Value: |
0.486744 |
Z-Factor: |
-6.98925 |
Fitness Defect: |
0.72 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|G2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2006-01-31 YYYY-MM-DD | Plate CH Control (+): | 0.038425±0.00059 | Plate DMSO Control (-): | 0.797875±0.01035 | Plate Z-Factor: | 0.9609 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5318562 |
5,7-dihydroxy-2,8-dimethyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 823 | Additional Members: 1 | Rows returned: 0 | |
|