| Compound Information | SONAR Target prediction |  | Name: | ISOEUGENITOL |  | Unique Identifier: | SPE00200449  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 196.115 g/mol |  | X log p: | 4.311  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1Oc2c(C)c(O)cc(O)c2C(=O)C=1 |  | Class: | chromone |  | Source: | Eugenia caryophyllata |  | Reference: | Helv Chim Acta 31: 1603 (1948) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		HTZ1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.2384±0.0502046 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9400±0.0449209 | 
	 
	
		| Z-Score: | 
		-0.3609±0.401992 | 
	 
	
		| p-Value: | 
		0.728834 | 
	 
	
		| Z-Factor: | 
		-9.06552 | 
	 
	
		| Fitness Defect: | 
		0.3163 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|G2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.40 Celcius |  | Date: | 2007-09-26 YYYY-MM-DD |  | Plate CH Control (+): | 0.040125±0.00054 |  | Plate DMSO Control (-): | 0.23112500000000002±0.07705 |  | Plate Z-Factor: | -0.5197 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 5318562 | 
		5,7-dihydroxy-2,8-dimethyl-chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 823 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |