| Compound Information | SONAR Target prediction | | Name: | EUGENITOL | | Unique Identifier: | SPE00200447 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 196.115 g/mol | | X log p: | 4.311 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1Oc2cc(O)c(C)c(O)c2C(=O)C=1 | | Class: | chromone | | Source: | Eugenia caryophyllata | | Reference: | Helv Chim Acta 31: 1603 (1948) |
| Species: |
4932 |
| Condition: |
COT1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6973±0.00799031 |
| Normalized OD Score: sc h |
0.9833±0.00595105 |
| Z-Score: |
-0.8629±0.297484 |
| p-Value: |
0.398616 |
| Z-Factor: |
-8.19221 |
| Fitness Defect: |
0.9198 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|F11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.40 Celcius | | Date: | 2007-11-20 YYYY-MM-DD | | Plate CH Control (+): | 0.040225±0.00102 | | Plate DMSO Control (-): | 0.6935±0.02592 | | Plate Z-Factor: | 0.8722 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5036604 |
5,7-dihydroxy-2,6-dimethyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 4376 | Additional Members: 4 | Rows returned: 2 | |
|