| Compound Information | SONAR Target prediction |  | Name: | XANTHOXYLIN |  | Unique Identifier: | SPE00200441  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 184.105 g/mol |  | X log p: | 5.11  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1cc(O)c(C(C)=O)c(OC)c1 |  | Class: | aromatic |  | Source: | Xanthoxylium spp, Artemisia brevifolia |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MET16 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6602±0.00586899 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9913±0.00354601 | 
	 
	
		| Z-Score: | 
		-0.4412±0.184059 | 
	 
	
		| p-Value: | 
		0.661728 | 
	 
	
		| Z-Factor: | 
		-23.7072 | 
	 
	
		| Fitness Defect: | 
		0.4129 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|F10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.70 Celcius |  | Date: | 2007-10-18 YYYY-MM-DD |  | Plate CH Control (+): | 0.039925±0.00062 |  | Plate DMSO Control (-): | 0.6535500000000001±0.02341 |  | Plate Z-Factor: | 0.8902 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 66654 | 
		1-(2-hydroxy-4,6-dimethoxy-phenyl)ethanone | 
	 
	
		| 70016 | 
		1-(2,4-dimethoxyphenyl)ethanone | 
	 
	
		| 123089 | 
		1-(2,4,6-trimethoxyphenyl)ethanone | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 |  |   
 
 |