| 
 | Compound Information | SONAR Target prediction |  | Name: | XANTHOXYLIN |  | Unique Identifier: | SPE00200441 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 184.105 g/mol |  | X log p: | 5.11  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1cc(O)c(C(C)=O)c(OC)c1 |  | Class: | aromatic |  | Source: | Xanthoxylium spp, Artemisia brevifolia | 
 
 
	
		| Species: | 4932 |  
		| Condition: | YPT6 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6780±0.00558614 |  
		| Normalized OD Score: sc h | 1.0188±0.00367596 |  
		| Z-Score: | 0.6351±0.154692 |  
		| p-Value: | 0.527822 |  
		| Z-Factor: | -2.56091 |  
		| Fitness Defect: | 0.639 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|F10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.80 Celcius |  | Date: | 2006-02-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.040475±0.00056 |  | Plate DMSO Control (-): | 0.6584±0.01585 |  | Plate Z-Factor: | 0.9353 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 66654 | 1-(2-hydroxy-4,6-dimethoxy-phenyl)ethanone |  
		| 70016 | 1-(2,4-dimethoxyphenyl)ethanone |  
		| 123089 | 1-(2,4,6-trimethoxyphenyl)ethanone |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 |  | 
 
 |