| Compound Information | SONAR Target prediction |  | Name: | PISCIDIC ACID |  | Unique Identifier: | SPE00200427  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 244.113 g/mol |  | X log p: | 5.057  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | OC(C(O)=O)C(O)(Cc1ccc(O)cc1)C(O)=O |  | Class: | aromatic |  | Source: | Piscidia piscipula |  | Reference: | J Chem Soc 1954: 3981; Acta Chem Scand 18: 1979 (1964); 20: 1431 (1966); Phytochemistry 18: 815 (1971) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		IRE1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7218±0.00205061 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0015±0.00607727 | 
	 
	
		| Z-Score: | 
		0.0233±0.327459 | 
	 
	
		| p-Value: | 
		0.816938 | 
	 
	
		| Z-Factor: | 
		-49.9799 | 
	 
	
		| Fitness Defect: | 
		0.2022 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|F9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.80 Celcius |  | Date: | 2007-11-23 YYYY-MM-DD |  | Plate CH Control (+): | 0.0401±0.00078 |  | Plate DMSO Control (-): | 0.708825±0.01895 |  | Plate Z-Factor: | 0.9119 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 120693 | 
		2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid | 
	 
	
		| 181726 | 
		2-hydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid | 
	 
	
		| 6710641 | 
		(2S,3R)-2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  nonactive | Cluster 367 | Additional Members: 6 | Rows returned: 4 |  |   
 
 |