| Compound Information | SONAR Target prediction |
| Name: | KOPARIN |
| Unique Identifier: | SPE00200422 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C16H12O6 |
| Molecular Weight: | 288.168 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | COc1ccc(c(O)c1O)C1=COc2cc(O)ccc2C1=O |
| Class: | isoflavone |
| Source: | Castanospermum australe |
| Reference: | Aust J Chem 30:1827 (1977) |
| Found: 73 nonactive | as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [73] |
| Species: | 4932 |
| Condition: | NTH1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6890±0.0124451 |
| Normalized OD Score: sc h | 0.9759±0.0185143 |
| Z-Score: | -1.2733±1.03858 |
| p-Value: | 0.3173 |
| Z-Factor: | -5.06681 |
| Fitness Defect: | 1.1479 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 8155 | Additional Members: 16 | Rows returned: 2 |
| SPE00201187 | 0.296296296296296 |
| SPE00102007 | 0 |
Service provided by the
Mike Tyers Laboratory