| 
 | Compound Information | SONAR Target prediction |  | Name: | KOPARIN 2--METHYL ETHER |  | Unique Identifier: | SPE00200416 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 300.178 g/mol |  | X log p: | 13.425  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccc(c(OC)c1O)C1=COc2cc(O)ccc2C1=O |  | Class: | isoflavone |  | Source: | Myroxylon peruiferum |  | Reference: | Phytochemistry 18: 815 (1971) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | VPS5 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.8303±0.00813173 |  
		| Normalized OD Score: sc h | 0.9972±0.00454883 |  
		| Z-Score: | -0.1536±0.246243 |  
		| p-Value: | 0.863376 |  
		| Z-Factor: | -24.247 |  
		| Fitness Defect: | 0.1469 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|A10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.00 Celcius |  | Date: | 2006-03-30 YYYY-MM-DD |  | Plate CH Control (+): | 0.0393±0.00198 |  | Plate DMSO Control (-): | 0.8187±0.01304 |  | Plate Z-Factor: | 0.9457 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 6710647 | 7-hydroxy-3-(3-hydroxy-2,4-dimethoxy-phenyl)chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 2 |  | 
 
 | active | Cluster 8155 | Additional Members: 16 | Rows returned: 3 |  | 
 
 |