Compound Information | SONAR Target prediction | Name: | KOPARIN 2--METHYL ETHER | Unique Identifier: | SPE00200416 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 300.178 g/mol | X log p: | 13.425 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(c(OC)c1O)C1=COc2cc(O)ccc2C1=O | Class: | isoflavone | Source: | Myroxylon peruiferum | Reference: | Phytochemistry 18: 815 (1971) |
Species: |
4932 |
Condition: |
HXT1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7044±0.00579828 |
Normalized OD Score: sc h |
0.9875±0.00618763 |
Z-Score: |
-0.6532±0.313268 |
p-Value: |
0.523874 |
Z-Factor: |
-14.663 |
Fitness Defect: |
0.6465 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|A10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.40 Celcius | Date: | 2007-11-27 YYYY-MM-DD | Plate CH Control (+): | 0.0411±0.00090 | Plate DMSO Control (-): | 0.6958249999999999±0.02214 | Plate Z-Factor: | 0.8873 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6710647 |
7-hydroxy-3-(3-hydroxy-2,4-dimethoxy-phenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 8155 | Additional Members: 16 | Rows returned: 3 | |
|