| Compound Information | SONAR Target prediction | | Name: | KOPARIN 2--METHYL ETHER | | Unique Identifier: | SPE00200416 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 300.178 g/mol | | X log p: | 13.425 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(c(OC)c1O)C1=COc2cc(O)ccc2C1=O | | Class: | isoflavone | | Source: | Myroxylon peruiferum | | Reference: | Phytochemistry 18: 815 (1971) |
| Species: |
4932 |
| Condition: |
COT1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7007±0.0153442 |
| Normalized OD Score: sc h |
0.9837±0.00231948 |
| Z-Score: |
-0.8453±0.130998 |
| p-Value: |
0.39999 |
| Z-Factor: |
-6.9306 |
| Fitness Defect: |
0.9163 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|A10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.60 Celcius | | Date: | 2007-11-20 YYYY-MM-DD | | Plate CH Control (+): | 0.040225±0.00110 | | Plate DMSO Control (-): | 0.695025±0.02358 | | Plate Z-Factor: | 0.8897 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 6710647 |
7-hydroxy-3-(3-hydroxy-2,4-dimethoxy-phenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 8155 | Additional Members: 16 | Rows returned: 3 | |
|