| Compound Information | SONAR Target prediction | | Name: | KOPARIN 2--METHYL ETHER | | Unique Identifier: | SPE00200416 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 300.178 g/mol | | X log p: | 13.425 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(c(OC)c1O)C1=COc2cc(O)ccc2C1=O | | Class: | isoflavone | | Source: | Myroxylon peruiferum | | Reference: | Phytochemistry 18: 815 (1971) |
| Species: |
4932 |
| Condition: |
VBA3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6695±0.00473762 |
| Normalized OD Score: sc h |
0.9812±0.0103316 |
| Z-Score: |
-0.9915±0.550805 |
| p-Value: |
0.357208 |
| Z-Factor: |
-4.70657 |
| Fitness Defect: |
1.0294 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 24|H5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.20 Celcius | | Date: | 2008-03-12 YYYY-MM-DD | | Plate CH Control (+): | 0.041550000000000004±0.00085 | | Plate DMSO Control (-): | 0.6579250000000001±0.01685 | | Plate Z-Factor: | 0.9289 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6710647 |
7-hydroxy-3-(3-hydroxy-2,4-dimethoxy-phenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 8155 | Additional Members: 16 | Rows returned: 3 | |
|
