Compound Information | SONAR Target prediction | Name: | ISOTECTORIGENIN, 7-METHYL ETHER | Unique Identifier: | SPE00200139 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.189 g/mol | X log p: | 13.778 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(cc1)C1=COc2c(OC)c(OC)cc(O)c2C1=O | Class: | isoflavone | Source: | Dalbergia spp |
Species: |
4932 |
Condition: |
MET16 |
Replicates: |
2 |
Raw OD Value: r im |
0.6383±0.0157685 |
Normalized OD Score: sc h |
0.9547±0.0222295 |
Z-Score: |
-2.2838±1.09859 |
p-Value: |
0.0670122 |
Z-Factor: |
-3.21004 |
Fitness Defect: |
2.7029 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-10-18 YYYY-MM-DD | Plate CH Control (+): | 0.039925±0.00062 | Plate DMSO Control (-): | 0.6535500000000001±0.02341 | Plate Z-Factor: | 0.8902 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6708795 |
5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5360 | Additional Members: 5 | Rows returned: 3 | |
|