Compound Information | SONAR Target prediction | Name: | ISOTECTORIGENIN, 7-METHYL ETHER | Unique Identifier: | SPE00200139 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.189 g/mol | X log p: | 13.778 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(cc1)C1=COc2c(OC)c(OC)cc(O)c2C1=O | Class: | isoflavone | Source: | Dalbergia spp |
Species: |
4932 |
Condition: |
TPK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7043±0.00558614 |
Normalized OD Score: sc h |
0.9968±0.00506636 |
Z-Score: |
-0.1556±0.25773 |
p-Value: |
0.857114 |
Z-Factor: |
-54.1938 |
Fitness Defect: |
0.1542 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 15|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2008-04-25 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00104 | Plate DMSO Control (-): | 0.7029749999999999±0.01302 | Plate Z-Factor: | 0.9450 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6708795 |
5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5360 | Additional Members: 5 | Rows returned: 3 | |
|