| Compound Information | SONAR Target prediction | | Name: | ISOTECTORIGENIN, 7-METHYL ETHER | | Unique Identifier: | SPE00200139 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 312.189 g/mol | | X log p: | 13.778 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 53.99 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1ccc(cc1)C1=COc2c(OC)c(OC)cc(O)c2C1=O | | Class: | isoflavone | | Source: | Dalbergia spp |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7023±0.0210011 |
| Normalized OD Score: sc h |
0.9413±0.00197075 |
| Z-Score: |
-2.5306±0.00623917 |
| p-Value: |
0.0113867 |
| Z-Factor: |
0.0261195 |
| Fitness Defect: |
4.4753 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 15|C4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.40 Celcius | | Date: | 2008-05-14 YYYY-MM-DD | | Plate CH Control (+): | 0.040275±0.00072 | | Plate DMSO Control (-): | 0.6904500000000001±0.01495 | | Plate Z-Factor: | 0.9226 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 6708795 |
5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 5360 | Additional Members: 5 | Rows returned: 3 | |
|