| Compound Information | SONAR Target prediction |
| Name: | PSOROMIC ACID |
| Unique Identifier: | SPE00200040 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C18H14O8 |
| Molecular Weight: | 344.188 g/mol |
| X log p: | 6.389 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 78.9 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 8 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | COc1cc(C(O)=O)c2Oc3c(C=O)c(O)cc(C)c3C(=O)Oc2c1C |
| Source: | mp 270-272 C |
| Reference: | J Pharm Soc Japan 59, 323 (1939) |
| Found: 94 nonactive | as graph: single | with analogs | [1] << Back 51 52 53 54 55 56 57 58 59 60 Next >> [94] |
| Species: | 4932 |
| Condition: | NUM1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7943±0.020294 |
| Normalized OD Score: sc h | 0.9968±0.0032517 |
| Z-Score: | -0.1436±0.142304 |
| p-Value: | 0.886406 |
| Z-Factor: | -8.25139 |
| Fitness Defect: | 0.1206 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 23725 |
| internal high similarity DBLink | Rows returned: 2 |
| SPE00200489 | 0.9262 |
| SPE01504106 | 0.9796 |
| active | Cluster 8237 | Additional Members: 3 | Rows returned: 1 |
| SPE01504106 | 0 |
Service provided by the
Mike Tyers Laboratory